C22H21N5O3S — CID 130474977
7-(3-acetylphenyl)-6-oxo-N-piperidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 130474977) has the molecular formula C22H21N5O3S and a molecular weight of 435.51 g/mol. Its IUPAC name is 7-(3-acetylphenyl)-6-oxo-N-piperidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-(3-acetylphenyl)-6-oxo-N-piperidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 130474977 |
| Molecular Formula | C22H21N5O3S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 7-(3-acetylphenyl)-6-oxo-N-piperidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | CC(=O)c1cccc(N2C(=O)Nc3c(C(=O)NC4CCCNC4)sc4nccc2c34)c1 |
| InChI | InChI=1S/C22H21N5O3S/c1-12(28)13-4-2-6-15(10-13)27-16-7-9-24-21-17(16)18(26-22(27)30)19(31-21)20(29)25-14-5-3-8-23-11-14/h2,4,6-7,9-10,14,23H,3,5,8,11H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | RLMMEIYAFKCSLP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |