C27H22F3N5O2S — CID 130475480
6-oxo-N-[(3R)-piperidin-3-yl]-7-[3-[2-(trifluoromethyl)phenyl]phenyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 130475480) has the molecular formula C27H22F3N5O2S and a molecular weight of 537.57 g/mol. Its IUPAC name is 6-oxo-N-[(3R)-piperidin-3-yl]-7-[3-[2-(trifluoromethyl)phenyl]phenyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 6-oxo-N-[(3R)-piperidin-3-yl]-7-[3-[2-(trifluoromethyl)phenyl]phenyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 130475480 |
| Molecular Formula | C27H22F3N5O2S |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 6-oxo-N-[(3R)-piperidin-3-yl]-7-[3-[2-(trifluoromethyl)phenyl]phenyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCNC1)c1sc2nccc3c2c1NC(=O)N3c1cccc(-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C27H22F3N5O2S/c28-27(29,30)19-9-2-1-8-18(19)15-5-3-7-17(13-15)35-20-10-12-32-25-21(20)22(34-26(35)37)23(38-25)24(36)33-16-6-4-11-31-14-16/h1-3,5,7-10,12-13,16,31H,4,6,11,14H2,(H,33,36)(H,34,37)/t16-/m1/s1 |
| InChIKey | XYUBSWRKFCSSKL-MRXNPFEDSA-N |
| XLogP | 6.15 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |