C27H25N5O2S — CID 130475024
7-[3-(2-methylphenyl)phenyl]-6-oxo-N-piperidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 130475024) has the molecular formula C27H25N5O2S and a molecular weight of 483.60 g/mol. Its IUPAC name is 7-[3-(2-methylphenyl)phenyl]-6-oxo-N-piperidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-[3-(2-methylphenyl)phenyl]-6-oxo-N-piperidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 130475024 |
| Molecular Formula | C27H25N5O2S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 7-[3-(2-methylphenyl)phenyl]-6-oxo-N-piperidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1ccccc1-c1cccc(N2C(=O)Nc3c(C(=O)NC4CCCNC4)sc4nccc2c34)c1 |
| InChI | InChI=1S/C27H25N5O2S/c1-16-6-2-3-10-20(16)17-7-4-9-19(14-17)32-21-11-13-29-26-22(21)23(31-27(32)34)24(35-26)25(33)30-18-8-5-12-28-15-18/h2-4,6-7,9-11,13-14,18,28H,5,8,12,15H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | ZQUCXJWLWFHYJG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |