C28H27N5O4S — CID 129220629
7-[4-(2-methoxyphenoxy)-2-methylphenyl]-6-oxo-N-piperidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129220629) has the molecular formula C28H27N5O4S and a molecular weight of 529.62 g/mol. Its IUPAC name is 7-[4-(2-methoxyphenoxy)-2-methylphenyl]-6-oxo-N-piperidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-[4-(2-methoxyphenoxy)-2-methylphenyl]-6-oxo-N-piperidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129220629 |
| Molecular Formula | C28H27N5O4S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 7-[4-(2-methoxyphenoxy)-2-methylphenyl]-6-oxo-N-piperidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | COc1ccccc1Oc1ccc(N2C(=O)Nc3c(C(=O)NC4CCCNC4)sc4nccc2c34)c(C)c1 |
| InChI | InChI=1S/C28H27N5O4S/c1-16-14-18(37-22-8-4-3-7-21(22)36-2)9-10-19(16)33-20-11-13-30-27-23(20)24(32-28(33)35)25(38-27)26(34)31-17-6-5-12-29-15-17/h3-4,7-11,13-14,17,29H,5-6,12,15H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | FBPDXFZWBXFKTH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |