C29H29N5O3S — CID 129223408
7-[4-(2-ethylphenoxy)-2-methylphenyl]-6-oxo-N-piperidin-4-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129223408) has the molecular formula C29H29N5O3S and a molecular weight of 527.65 g/mol. Its IUPAC name is 7-[4-(2-ethylphenoxy)-2-methylphenyl]-6-oxo-N-piperidin-4-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-[4-(2-ethylphenoxy)-2-methylphenyl]-6-oxo-N-piperidin-4-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129223408 |
| Molecular Formula | C29H29N5O3S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 7-[4-(2-ethylphenoxy)-2-methylphenyl]-6-oxo-N-piperidin-4-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | CCc1ccccc1Oc1ccc(N2C(=O)Nc3c(C(=O)NC4CCNCC4)sc4nccc2c34)c(C)c1 |
| InChI | InChI=1S/C29H29N5O3S/c1-3-18-6-4-5-7-23(18)37-20-8-9-21(17(2)16-20)34-22-12-15-31-28-24(22)25(33-29(34)36)26(38-28)27(35)32-19-10-13-30-14-11-19/h4-9,12,15-16,19,30H,3,10-11,13-14H2,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | DUEQHURMCJGLCN-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |