C21H21N5O3S — CID 130475147
7-(4-methoxy-2-methylphenyl)-6-oxo-N-[(3R)-pyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 130475147) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is 7-(4-methoxy-2-methylphenyl)-6-oxo-N-[(3R)-pyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-(4-methoxy-2-methylphenyl)-6-oxo-N-[(3R)-pyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 130475147 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 7-(4-methoxy-2-methylphenyl)-6-oxo-N-[(3R)-pyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | COc1ccc(N2C(=O)Nc3c(C(=O)N[C@@H]4CCNC4)sc4nccc2c34)c(C)c1 |
| InChI | InChI=1S/C21H21N5O3S/c1-11-9-13(29-2)3-4-14(11)26-15-6-8-23-20-16(15)17(25-21(26)28)18(30-20)19(27)24-12-5-7-22-10-12/h3-4,6,8-9,12,22H,5,7,10H2,1-2H3,(H,24,27)(H,25,28)/t12-/m1/s1 |
| InChIKey | WKKOESVHSDEILW-GFCCVEGCSA-N |
| XLogP | 3.39 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |