C24H20N6O2S — CID 130474991
6-oxo-7-(2-phenyl-4-pyridinyl)-N-pyrrolidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 130474991) has the molecular formula C24H20N6O2S and a molecular weight of 456.53 g/mol. Its IUPAC name is 6-oxo-7-(2-phenyl-4-pyridinyl)-N-pyrrolidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 6-oxo-7-(2-phenyl-4-pyridinyl)-N-pyrrolidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 130474991 |
| Molecular Formula | C24H20N6O2S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 6-oxo-7-(2-phenyl-4-pyridinyl)-N-pyrrolidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | O=C(NC1CCNC1)c1sc2nccc3c2c1NC(=O)N3c1ccnc(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H20N6O2S/c31-22(28-15-6-9-25-13-15)21-20-19-18(8-11-27-23(19)33-21)30(24(32)29-20)16-7-10-26-17(12-16)14-4-2-1-3-5-14/h1-5,7-8,10-12,15,25H,6,9,13H2,(H,28,31)(H,29,32) |
| InChIKey | HQQJNRQBEDIHLY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |