C24H20N6O3S — CID 130475156
6-oxo-7-(6-phenoxy-3-pyridinyl)-N-pyrrolidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 130475156) has the molecular formula C24H20N6O3S and a molecular weight of 472.53 g/mol. Its IUPAC name is 6-oxo-7-(6-phenoxy-3-pyridinyl)-N-pyrrolidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 6-oxo-7-(6-phenoxy-3-pyridinyl)-N-pyrrolidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 130475156 |
| Molecular Formula | C24H20N6O3S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 6-oxo-7-(6-phenoxy-3-pyridinyl)-N-pyrrolidin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | O=C(NC1CCNC1)c1sc2nccc3c2c1NC(=O)N3c1ccc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C24H20N6O3S/c31-22(28-14-8-10-25-12-14)21-20-19-17(9-11-26-23(19)34-21)30(24(32)29-20)15-6-7-18(27-13-15)33-16-4-2-1-3-5-16/h1-7,9,11,13-14,25H,8,10,12H2,(H,28,31)(H,29,32) |
| InChIKey | JXLLXHBUBPMHAB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |