C25H21N5O3S — CID 129234180
N-[(1R)-2-hydroxycyclopentyl]-6-oxo-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129234180) has the molecular formula C25H21N5O3S and a molecular weight of 471.54 g/mol. Its IUPAC name is N-[(1R)-2-hydroxycyclopentyl]-6-oxo-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[(1R)-2-hydroxycyclopentyl]-6-oxo-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129234180 |
| Molecular Formula | C25H21N5O3S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | N-[(1R)-2-hydroxycyclopentyl]-6-oxo-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC1O)c1sc2nccc3c2c1NC(=O)N3c1ccnc(-c2ccccc2)c1 |
| InChI | InChI=1S/C25H21N5O3S/c31-19-8-4-7-16(19)28-23(32)22-21-20-18(10-12-27-24(20)34-22)30(25(33)29-21)15-9-11-26-17(13-15)14-5-2-1-3-6-14/h1-3,5-6,9-13,16,19,31H,4,7-8H2,(H,28,32)(H,29,33)/t16-,19?/m1/s1 |
| InChIKey | XMJBYWMGKCAFQS-VTBWFHPJSA-N |
| XLogP | 4.69 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |