C24H21N7O2S — CID 129233693
N-[(1R,2S)-2-aminocyclopentyl]-6-oxo-7-(6-phenylpyrimidin-4-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129233693) has the molecular formula C24H21N7O2S and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[(1R,2S)-2-aminocyclopentyl]-6-oxo-7-(6-phenylpyrimidin-4-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[(1R,2S)-2-aminocyclopentyl]-6-oxo-7-(6-phenylpyrimidin-4-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129233693 |
| Molecular Formula | C24H21N7O2S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[(1R,2S)-2-aminocyclopentyl]-6-oxo-7-(6-phenylpyrimidin-4-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | N[C@H]1CCC[C@H]1NC(=O)c1sc2nccc3c2c1NC(=O)N3c1cc(-c2ccccc2)ncn1 |
| InChI | InChI=1S/C24H21N7O2S/c25-14-7-4-8-15(14)29-22(32)21-20-19-17(9-10-26-23(19)34-21)31(24(33)30-20)18-11-16(27-12-28-18)13-5-2-1-3-6-13/h1-3,5-6,9-12,14-15H,4,7-8,25H2,(H,29,32)(H,30,33)/t14-,15+/m0/s1 |
| InChIKey | YUGLIFZTPOZTDJ-LSDHHAIUSA-N |
| XLogP | 4.05 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |