C26H26N6OS — CID 129233994
3-[[[(1R,2S)-2-aminocyclohexyl]amino]methyl]-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one (PubChem CID 129233994) has the molecular formula C26H26N6OS and a molecular weight of 470.60 g/mol. Its IUPAC name is 3-[[[(1R,2S)-2-aminocyclohexyl]amino]methyl]-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one.
| Compound Name | 3-[[[(1R,2S)-2-aminocyclohexyl]amino]methyl]-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
|---|---|
| PubChem CID | 129233994 |
| Molecular Formula | C26H26N6OS |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 3-[[[(1R,2S)-2-aminocyclohexyl]amino]methyl]-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
| SMILES | N[C@H]1CCCC[C@H]1NCc1sc2nccc3c2c1NC(=O)N3c1ccnc(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H26N6OS/c27-18-8-4-5-9-19(18)30-15-22-24-23-21(11-13-29-25(23)34-22)32(26(33)31-24)17-10-12-28-20(14-17)16-6-2-1-3-7-16/h1-3,6-7,10-14,18-19,30H,4-5,8-9,15,27H2,(H,31,33)/t18-,19+/m0/s1 |
| InChIKey | IWNFKCOVYABIJA-RBUKOAKNSA-N |
| XLogP | 5.40 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |