C28H27N7O3S — CID 129234229
N-[(1S,2R)-2-[[6-oxo-7-(5-phenoxypyrimidin-2-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]methylamino]cyclohexyl]prop-2-enamide (PubChem CID 129234229) has the molecular formula C28H27N7O3S and a molecular weight of 541.64 g/mol. Its IUPAC name is N-[(1S,2R)-2-[[6-oxo-7-(5-phenoxypyrimidin-2-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]methylamino]cyclohexyl]prop-2-enamide.
| Compound Name | N-[(1S,2R)-2-[[6-oxo-7-(5-phenoxypyrimidin-2-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]methylamino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 129234229 |
| Molecular Formula | C28H27N7O3S |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | N-[(1S,2R)-2-[[6-oxo-7-(5-phenoxypyrimidin-2-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]methylamino]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCCC[C@H]1NCc1sc2nccc3c2c1NC(=O)N3c1ncc(Oc2ccccc2)cn1 |
| InChI | InChI=1S/C28H27N7O3S/c1-2-23(36)33-20-11-7-6-10-19(20)30-16-22-25-24-21(12-13-29-26(24)39-22)35(28(37)34-25)27-31-14-18(15-32-27)38-17-8-4-3-5-9-17/h2-5,8-9,12-15,19-20,30H,1,6-7,10-11,16H2,(H,33,36)(H,34,37)/t19-,20+/m1/s1 |
| InChIKey | PHYOLEYTXMYPNP-UXHICEINSA-N |
| XLogP | 5.27 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|