C30H29N5O4S — CID 146639128
N-[4-[[hydroxy-[6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]methyl]amino]cyclohexyl]prop-2-enamide (PubChem CID 146639128) has the molecular formula C30H29N5O4S and a molecular weight of 555.66 g/mol. Its IUPAC name is N-[4-[[hydroxy-[6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]methyl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | N-[4-[[hydroxy-[6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]methyl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 146639128 |
| Molecular Formula | C30H29N5O4S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | N-[4-[[hydroxy-[6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]methyl]amino]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCC(NC(O)c2sc3nccc4c3c2NC(=O)N4c2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C30H29N5O4S/c1-2-24(36)32-18-8-10-19(11-9-18)33-28(37)27-26-25-23(16-17-31-29(25)40-27)35(30(38)34-26)20-12-14-22(15-13-20)39-21-6-4-3-5-7-21/h2-7,12-19,28,33,37H,1,8-11H2,(H,32,36)(H,34,38) |
| InChIKey | OHMIGYUVOINGMS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|