C28H36N4O3S — CID 130476269
3-(5-ethyl-4-oxo-1,2,3,6-tetrahydro-1,5-benzodiazocin-8-yl)-N-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]propanamide (PubChem CID 130476269) has the molecular formula C28H36N4O3S and a molecular weight of 508.69 g/mol. Its IUPAC name is 3-(5-ethyl-4-oxo-1,2,3,6-tetrahydro-1,5-benzodiazocin-8-yl)-N-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]propanamide.
| Compound Name | 3-(5-ethyl-4-oxo-1,2,3,6-tetrahydro-1,5-benzodiazocin-8-yl)-N-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 130476269 |
| Molecular Formula | C28H36N4O3S |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 3-(5-ethyl-4-oxo-1,2,3,6-tetrahydro-1,5-benzodiazocin-8-yl)-N-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]propanamide |
| SMILES | CCN1Cc2cc(CCC(=O)NCC(=O)N3CCC[C@@H]3c3ccccc3SC)ccc2NCCC1=O |
| InChI | InChI=1S/C28H36N4O3S/c1-3-31-19-21-17-20(10-12-23(21)29-15-14-27(31)34)11-13-26(33)30-18-28(35)32-16-6-8-24(32)22-7-4-5-9-25(22)36-2/h4-5,7,9-10,12,17,24,29H,3,6,8,11,13-16,18-19H2,1-2H3,(H,30,33)/t24-/m1/s1 |
| InChIKey | VBCFNWAKUIRDJO-XMMPIXPASA-N |
| XLogP | 3.99 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |