C24H30O2 — CID 130476683
3-ethyl-3-[[4-[4-[(3-ethyloxetan-3-yl)methyl]phenyl]phenyl]methyl]oxetane (PubChem CID 130476683) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is 3-ethyl-3-[[4-[4-[(3-ethyloxetan-3-yl)methyl]phenyl]phenyl]methyl]oxetane.
| Compound Name | 3-ethyl-3-[[4-[4-[(3-ethyloxetan-3-yl)methyl]phenyl]phenyl]methyl]oxetane |
|---|---|
| PubChem CID | 130476683 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 3-ethyl-3-[[4-[4-[(3-ethyloxetan-3-yl)methyl]phenyl]phenyl]methyl]oxetane |
| SMILES | CCC1(Cc2ccc(-c3ccc(CC4(CC)COC4)cc3)cc2)COC1 |
| InChI | InChI=1S/C24H30O2/c1-3-23(15-25-16-23)13-19-5-9-21(10-6-19)22-11-7-20(8-12-22)14-24(4-2)17-26-18-24/h5-12H,3-4,13-18H2,1-2H3 |
| InChIKey | WOXVPDRHBGJSQW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |