C23H30O3 — CID 147383497
[4-[4-[2-[(3-ethyloxetan-3-yl)methoxy]butyl]phenyl]phenyl]methanol (PubChem CID 147383497) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is [4-[4-[2-[(3-ethyloxetan-3-yl)methoxy]butyl]phenyl]phenyl]methanol.
| Compound Name | [4-[4-[2-[(3-ethyloxetan-3-yl)methoxy]butyl]phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 147383497 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [4-[4-[2-[(3-ethyloxetan-3-yl)methoxy]butyl]phenyl]phenyl]methanol |
| SMILES | CCC(Cc1ccc(-c2ccc(CO)cc2)cc1)OCC1(CC)COC1 |
| InChI | InChI=1S/C23H30O3/c1-3-22(26-17-23(4-2)15-25-16-23)13-18-5-9-20(10-6-18)21-11-7-19(14-24)8-12-21/h5-12,22,24H,3-4,13-17H2,1-2H3 |
| InChIKey | DLLJQRZREMLIBB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |