C10H17NO2S — CID 130481421
2-(4-methylpent-1-yn-3-yl)thiazinane 1,1-dioxide (PubChem CID 130481421) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-(4-methylpent-1-yn-3-yl)thiazinane 1,1-dioxide.
| Compound Name | 2-(4-methylpent-1-yn-3-yl)thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 130481421 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 2-(4-methylpent-1-yn-3-yl)thiazinane 1,1-dioxide |
| SMILES | C#CC(C(C)C)N1CCCCS1(=O)=O |
| InChI | InChI=1S/C10H17NO2S/c1-4-10(9(2)3)11-7-5-6-8-14(11,12)13/h1,9-10H,5-8H2,2-3H3 |
| InChIKey | BUFMHPAXLSODGU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|