C13H20N2O6S — CID 134397902
(2,5-dioxopyrrolidin-1-yl) (2S)-2-(1,1-dioxothiazinan-2-yl)-3-methylbutanoate (PubChem CID 134397902) has the molecular formula C13H20N2O6S and a molecular weight of 332.38 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S)-2-(1,1-dioxothiazinan-2-yl)-3-methylbutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-(1,1-dioxothiazinan-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 134397902 |
| Molecular Formula | C13H20N2O6S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-(1,1-dioxothiazinan-2-yl)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)ON1C(=O)CCC1=O)N1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H20N2O6S/c1-9(2)12(14-7-3-4-8-22(14,19)20)13(18)21-15-10(16)5-6-11(15)17/h9,12H,3-8H2,1-2H3/t12-/m0/s1 |
| InChIKey | SAHOAKONDLKQTI-LBPRGKRZSA-N |
| XLogP | 0.04 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|