C11H15N3 — CID 130481643
4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine (PubChem CID 130481643) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine.
| Compound Name | 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 130481643 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine |
| SMILES | C#CC(Nc1ccncc1N)C(C)C |
| InChI | InChI=1S/C11H15N3/c1-4-10(8(2)3)14-11-5-6-13-7-9(11)12/h1,5-8,10H,12H2,2-3H3,(H,13,14) |
| InChIKey | UTLCLVSKEXNWET-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|