About 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine
4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine (PubChem CID 130481643) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine.
Molecular Properties
| Compound Name | 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine |
| PubChem CID | 130481643 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine |
| SMILES | C#CC(Nc1ccncc1N)C(C)C |
| InChI | InChI=1S/C11H15N3/c1-4-10(8(2)3)14-11-5-6-13-7-9(11)12/h1,5-8,10H,12H2,2-3H3,(H,13,14) |
| InChIKey | UTLCLVSKEXNWET-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine?
The IUPAC name of 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine (CID 130481643) is 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine.
What is the SMILES notation for 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine?
The canonical SMILES for 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine is C#CC(Nc1ccncc1N)C(C)C.
What is the InChIKey of 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine?
The InChIKey is UTLCLVSKEXNWET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-4-10(8(2)3)14-11-5-6-13-7-9(11)12/h1,5-8,10H,12H2,2-3H3,(H,13,14).
What are the key properties of 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine?
4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine has a molecular weight of 189.26 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(4-methylpent-1-yn-3-yl)pyridine-3,4-diamine is sourced from PubChem (CID 130481643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).