C9H15N3O2S — CID 64630420
4-N-(1-methylsulfonylpropan-2-yl)pyridine-3,4-diamine (PubChem CID 64630420) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is 4-N-(1-methylsulfonylpropan-2-yl)pyridine-3,4-diamine.
| Compound Name | 4-N-(1-methylsulfonylpropan-2-yl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 64630420 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 4-N-(1-methylsulfonylpropan-2-yl)pyridine-3,4-diamine |
| SMILES | CC(CS(C)(=O)=O)Nc1ccncc1N |
| InChI | InChI=1S/C9H15N3O2S/c1-7(6-15(2,13)14)12-9-3-4-11-5-8(9)10/h3-5,7H,6,10H2,1-2H3,(H,11,12) |
| InChIKey | AEADXOIUSLBEFM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |