C16H21N3O — CID 166432739
4-N-(4-phenylmethoxybutan-2-yl)pyridine-3,4-diamine (PubChem CID 166432739) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-N-(4-phenylmethoxybutan-2-yl)pyridine-3,4-diamine.
| Compound Name | 4-N-(4-phenylmethoxybutan-2-yl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 166432739 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-N-(4-phenylmethoxybutan-2-yl)pyridine-3,4-diamine |
| SMILES | CC(CCOCc1ccccc1)Nc1ccncc1N |
| InChI | InChI=1S/C16H21N3O/c1-13(19-16-7-9-18-11-15(16)17)8-10-20-12-14-5-3-2-4-6-14/h2-7,9,11,13H,8,10,12,17H2,1H3,(H,18,19) |
| InChIKey | GSURALULERKUIM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|