C9H13ClN2O4S2 — CID 64629810
4-chloro-N-(1-methylsulfonylpropan-2-yl)pyridine-3-sulfonamide (PubChem CID 64629810) has the molecular formula C9H13ClN2O4S2 and a molecular weight of 312.80 g/mol. Its IUPAC name is 4-chloro-N-(1-methylsulfonylpropan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 4-chloro-N-(1-methylsulfonylpropan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64629810 |
| Molecular Formula | C9H13ClN2O4S2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 4-chloro-N-(1-methylsulfonylpropan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(CS(C)(=O)=O)NS(=O)(=O)c1cnccc1Cl |
| InChI | InChI=1S/C9H13ClN2O4S2/c1-7(6-17(2,13)14)12-18(15,16)9-5-11-4-3-8(9)10/h3-5,7,12H,6H2,1-2H3 |
| InChIKey | DEWMJNWAANHMSA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |