C8H10N2O2 — CID 130481843
1-(1-methylcyclopropyl)imidazole-4-carboxylic acid (PubChem CID 130481843) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-(1-methylcyclopropyl)imidazole-4-carboxylic acid.
| Compound Name | 1-(1-methylcyclopropyl)imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 130481843 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 1-(1-methylcyclopropyl)imidazole-4-carboxylic acid |
| SMILES | CC1(n2cnc(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C8H10N2O2/c1-8(2-3-8)10-4-6(7(11)12)9-5-10/h4-5H,2-3H2,1H3,(H,11,12) |
| InChIKey | DQRILONJCCECJN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |