C11H17ClN2O — CID 130482376
4-(chloromethyl)-1-(2,2-dimethyloxan-4-yl)imidazole (PubChem CID 130482376) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(2,2-dimethyloxan-4-yl)imidazole.
| Compound Name | 4-(chloromethyl)-1-(2,2-dimethyloxan-4-yl)imidazole |
|---|---|
| PubChem CID | 130482376 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-(chloromethyl)-1-(2,2-dimethyloxan-4-yl)imidazole |
| SMILES | CC1(C)CC(n2cnc(CCl)c2)CCO1 |
| InChI | InChI=1S/C11H17ClN2O/c1-11(2)5-10(3-4-15-11)14-7-9(6-12)13-8-14/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | GOHXNESHDITPEU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|