C16H20BrClN2O — CID 83034239
6-bromo-2-(2-chloroethyl)-1-(2,2-dimethyloxan-4-yl)benzimidazole (PubChem CID 83034239) has the molecular formula C16H20BrClN2O and a molecular weight of 371.71 g/mol. Its IUPAC name is 6-bromo-2-(2-chloroethyl)-1-(2,2-dimethyloxan-4-yl)benzimidazole.
| Compound Name | 6-bromo-2-(2-chloroethyl)-1-(2,2-dimethyloxan-4-yl)benzimidazole |
|---|---|
| PubChem CID | 83034239 |
| Molecular Formula | C16H20BrClN2O |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 6-bromo-2-(2-chloroethyl)-1-(2,2-dimethyloxan-4-yl)benzimidazole |
| SMILES | CC1(C)CC(n2c(CCCl)nc3ccc(Br)cc32)CCO1 |
| InChI | InChI=1S/C16H20BrClN2O/c1-16(2)10-12(6-8-21-16)20-14-9-11(17)3-4-13(14)19-15(20)5-7-18/h3-4,9,12H,5-8,10H2,1-2H3 |
| InChIKey | QJBXAMUPJNCDDZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|