C14H18FN3O — CID 83028668
1-(2,2-dimethyloxan-4-yl)-6-fluorobenzimidazol-2-amine (PubChem CID 83028668) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is 1-(2,2-dimethyloxan-4-yl)-6-fluorobenzimidazol-2-amine.
| Compound Name | 1-(2,2-dimethyloxan-4-yl)-6-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 83028668 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-(2,2-dimethyloxan-4-yl)-6-fluorobenzimidazol-2-amine |
| SMILES | CC1(C)CC(n2c(N)nc3ccc(F)cc32)CCO1 |
| InChI | InChI=1S/C14H18FN3O/c1-14(2)8-10(5-6-19-14)18-12-7-9(15)3-4-11(12)17-13(18)16/h3-4,7,10H,5-6,8H2,1-2H3,(H2,16,17) |
| InChIKey | RKVBMDRDRYHECN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |