C14H25Cl — CID 130489062
1-(chloromethyl)-2,2-dimethyl-8-propan-2-ylspiro[2.5]octane (PubChem CID 130489062) has the molecular formula C14H25Cl and a molecular weight of 228.81 g/mol. Its IUPAC name is 1-(chloromethyl)-2,2-dimethyl-8-propan-2-ylspiro[2.5]octane.
| Compound Name | 1-(chloromethyl)-2,2-dimethyl-8-propan-2-ylspiro[2.5]octane |
|---|---|
| PubChem CID | 130489062 |
| Molecular Formula | C14H25Cl |
| Molecular Weight | 228.81 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1-(chloromethyl)-2,2-dimethyl-8-propan-2-ylspiro[2.5]octane |
| SMILES | CC(C)C1CCCCC12C(CCl)C2(C)C |
| InChI | InChI=1S/C14H25Cl/c1-10(2)11-7-5-6-8-14(11)12(9-15)13(14,3)4/h10-12H,5-9H2,1-4H3 |
| InChIKey | OJNCVEABKBKNIP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|