C7H13N3O — CID 130490616
1-hydrazinyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 130490616) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 1-hydrazinyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | 1-hydrazinyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 130490616 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 1-hydrazinyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | NNC1CC(=O)N2CCCC12 |
| InChI | InChI=1S/C7H13N3O/c8-9-5-4-7(11)10-3-1-2-6(5)10/h5-6,9H,1-4,8H2 |
| InChIKey | RBZPLRMKGPXZKE-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|