C8H13NO3S — CID 130495419
3-(2-hydroxy-3-methylbutyl)-1,3-thiazolidine-2,4-dione (PubChem CID 130495419) has the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is 3-(2-hydroxy-3-methylbutyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-(2-hydroxy-3-methylbutyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 130495419 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 3-(2-hydroxy-3-methylbutyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)C(O)CN1C(=O)CSC1=O |
| InChI | InChI=1S/C8H13NO3S/c1-5(2)6(10)3-9-7(11)4-13-8(9)12/h5-6,10H,3-4H2,1-2H3 |
| InChIKey | WJSXGVYWFDQTQB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|