C10H18N4 — CID 130495987
1-(1-ethylpyrazol-3-yl)-2-methylpiperazine (PubChem CID 130495987) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(1-ethylpyrazol-3-yl)-2-methylpiperazine.
| Compound Name | 1-(1-ethylpyrazol-3-yl)-2-methylpiperazine |
|---|---|
| PubChem CID | 130495987 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-(1-ethylpyrazol-3-yl)-2-methylpiperazine |
| SMILES | CCn1ccc(N2CCNCC2C)n1 |
| InChI | InChI=1S/C10H18N4/c1-3-13-6-4-10(12-13)14-7-5-11-8-9(14)2/h4,6,9,11H,3,5,7-8H2,1-2H3 |
| InChIKey | HSNYJBHLEZEFSK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |