C9H14N4 — CID 130496237
3-[(1-ethylpyrazol-3-yl)amino]-2-methylpropanenitrile (PubChem CID 130496237) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 3-[(1-ethylpyrazol-3-yl)amino]-2-methylpropanenitrile.
| Compound Name | 3-[(1-ethylpyrazol-3-yl)amino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 130496237 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 3-[(1-ethylpyrazol-3-yl)amino]-2-methylpropanenitrile |
| SMILES | CCn1ccc(NCC(C)C#N)n1 |
| InChI | InChI=1S/C9H14N4/c1-3-13-5-4-9(12-13)11-7-8(2)6-10/h4-5,8H,3,7H2,1-2H3,(H,11,12) |
| InChIKey | UENVTUULORNKGM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |