C7H13N5 — CID 130496867
1-(1,5-dimethylpyrazol-3-yl)-2-methylguanidine (PubChem CID 130496867) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-3-yl)-2-methylguanidine.
| Compound Name | 1-(1,5-dimethylpyrazol-3-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 130496867 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-3-yl)-2-methylguanidine |
| SMILES | C/N=C(\N)Nc1cc(C)n(C)n1 |
| InChI | InChI=1S/C7H13N5/c1-5-4-6(11-12(5)3)10-7(8)9-2/h4H,1-3H3,(H3,8,9,10,11) |
| InChIKey | RJPCDPLXSWUNCD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|