About 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole
3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole (PubChem CID 130497189) has the molecular formula C9H11ClN4
and a molecular weight of 210.67 g/mol. Its IUPAC name is 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole |
| PubChem CID | 130497189 |
| Molecular Formula | C9H11ClN4 |
| Molecular Weight | 210.67 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole |
| SMILES | Cc1cc(-n2cnc(CCl)c2)nn1C |
| InChI | InChI=1S/C9H11ClN4/c1-7-3-9(12-13(7)2)14-5-8(4-10)11-6-14/h3,5-6H,4H2,1-2H3 |
| InChIKey | UWOYSCJHVMJEGR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole?
The IUPAC name of 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole (CID 130497189) is 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole.
What is the SMILES notation for 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole?
The canonical SMILES for 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole is Cc1cc(-n2cnc(CCl)c2)nn1C.
What is the InChIKey of 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole?
The InChIKey is UWOYSCJHVMJEGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN4/c1-7-3-9(12-13(7)2)14-5-8(4-10)11-6-14/h3,5-6H,4H2,1-2H3.
What are the key properties of 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole?
3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole has a molecular weight of 210.67 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole is sourced from PubChem (CID 130497189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).