C9H11ClN4 — CID 130497189
3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole (PubChem CID 130497189) has the molecular formula C9H11ClN4 and a molecular weight of 210.67 g/mol. Its IUPAC name is 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole.
| Compound Name | 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole |
|---|---|
| PubChem CID | 130497189 |
| Molecular Formula | C9H11ClN4 |
| Molecular Weight | 210.67 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 3-[4-(chloromethyl)imidazol-1-yl]-1,5-dimethylpyrazole |
| SMILES | Cc1cc(-n2cnc(CCl)c2)nn1C |
| InChI | InChI=1S/C9H11ClN4/c1-7-3-9(12-13(7)2)14-5-8(4-10)11-6-14/h3,5-6H,4H2,1-2H3 |
| InChIKey | UWOYSCJHVMJEGR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|