C7H12FNO2 — CID 130504698
2-(2-fluoroethylamino)cyclobutane-1-carboxylic acid (PubChem CID 130504698) has the molecular formula C7H12FNO2 and a molecular weight of 161.18 g/mol. Its IUPAC name is 2-(2-fluoroethylamino)cyclobutane-1-carboxylic acid.
| Compound Name | 2-(2-fluoroethylamino)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 130504698 |
| Molecular Formula | C7H12FNO2 |
| Molecular Weight | 161.18 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | 2-(2-fluoroethylamino)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1NCCF |
| InChI | InChI=1S/C7H12FNO2/c8-3-4-9-6-2-1-5(6)7(10)11/h5-6,9H,1-4H2,(H,10,11) |
| InChIKey | PTXWFBAZBAXPKG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |