C11H20N2O2 — CID 103248849
2-(2-pyrrolidin-1-ylethylamino)cyclobutane-1-carboxylic acid (PubChem CID 103248849) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-(2-pyrrolidin-1-ylethylamino)cyclobutane-1-carboxylic acid.
| Compound Name | 2-(2-pyrrolidin-1-ylethylamino)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 103248849 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-(2-pyrrolidin-1-ylethylamino)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1NCCN1CCCC1 |
| InChI | InChI=1S/C11H20N2O2/c14-11(15)9-3-4-10(9)12-5-8-13-6-1-2-7-13/h9-10,12H,1-8H2,(H,14,15) |
| InChIKey | NYNYUVZKODTLTG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |