About 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole
1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole (PubChem CID 130508233) has the molecular formula C8H5BrI2N2S
and a molecular weight of 494.92 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole.
Molecular Properties
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole |
| PubChem CID | 130508233 |
| Molecular Formula | C8H5BrI2N2S |
| Molecular Weight | 494.92 g/mol |
| Exact Mass | 493.74 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole |
| SMILES | Brc1ccc(Cn2cnc(I)c2I)s1 |
| InChI | InChI=1S/C8H5BrI2N2S/c9-6-2-1-5(14-6)3-13-4-12-7(10)8(13)11/h1-2,4H,3H2 |
| InChIKey | IPXHZZXHWMHLGZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.92 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole?
The IUPAC name of 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole (CID 130508233) is 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole.
What is the SMILES notation for 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole?
The canonical SMILES for 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole is Brc1ccc(Cn2cnc(I)c2I)s1.
What is the InChIKey of 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole?
The InChIKey is IPXHZZXHWMHLGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrI2N2S/c9-6-2-1-5(14-6)3-13-4-12-7(10)8(13)11/h1-2,4H,3H2.
What are the key properties of 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole?
1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole has a molecular weight of 494.92 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole is sourced from PubChem (CID 130508233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).