C8H5BrI2N2S — CID 130508233
1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole (PubChem CID 130508233) has the molecular formula C8H5BrI2N2S and a molecular weight of 494.92 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole |
|---|---|
| PubChem CID | 130508233 |
| Molecular Formula | C8H5BrI2N2S |
| Molecular Weight | 494.92 g/mol |
| Exact Mass | 493.74 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-4,5-diiodoimidazole |
| SMILES | Brc1ccc(Cn2cnc(I)c2I)s1 |
| InChI | InChI=1S/C8H5BrI2N2S/c9-6-2-1-5(14-6)3-13-4-12-7(10)8(13)11/h1-2,4H,3H2 |
| InChIKey | IPXHZZXHWMHLGZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.92 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|