C19H20I4N2O4 — CID 13050885
2-(4-aminobutylamino)-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid (PubChem CID 13050885) has the molecular formula C19H20I4N2O4 and a molecular weight of 847.99 g/mol. Its IUPAC name is 2-(4-aminobutylamino)-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid.
| Compound Name | 2-(4-aminobutylamino)-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
|---|---|
| PubChem CID | 13050885 |
| Molecular Formula | C19H20I4N2O4 |
| Molecular Weight | 847.99 g/mol |
| Exact Mass | 847.76 |
| IUPAC Name | 2-(4-aminobutylamino)-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
| SMILES | NCCCCNC(Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C19H20I4N2O4/c20-12-8-11(9-13(21)17(12)26)29-18-14(22)5-10(6-15(18)23)7-16(19(27)28)25-4-2-1-3-24/h5-6,8-9,16,25-26H,1-4,7,24H2,(H,27,28) |
| InChIKey | DADKDJPNHHCOBS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.99 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|