C9H15FN2 — CID 130510906
3-(2,5-dihydro-1H-pyrrol-2-yl)-3-fluoropiperidine (PubChem CID 130510906) has the molecular formula C9H15FN2 and a molecular weight of 170.23 g/mol. Its IUPAC name is 3-(2,5-dihydro-1H-pyrrol-2-yl)-3-fluoropiperidine.
| Compound Name | 3-(2,5-dihydro-1H-pyrrol-2-yl)-3-fluoropiperidine |
|---|---|
| PubChem CID | 130510906 |
| Molecular Formula | C9H15FN2 |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 3-(2,5-dihydro-1H-pyrrol-2-yl)-3-fluoropiperidine |
| SMILES | FC1(C2C=CCN2)CCCNC1 |
| InChI | InChI=1S/C9H15FN2/c10-9(4-2-5-11-7-9)8-3-1-6-12-8/h1,3,8,11-12H,2,4-7H2 |
| InChIKey | PPIRSUHPQNHAFT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|