C10H17FN2 — CID 130510926
2-[2,5-dihydro-1H-pyrrol-2-yl(fluoro)methyl]piperidine (PubChem CID 130510926) has the molecular formula C10H17FN2 and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-[2,5-dihydro-1H-pyrrol-2-yl(fluoro)methyl]piperidine.
| Compound Name | 2-[2,5-dihydro-1H-pyrrol-2-yl(fluoro)methyl]piperidine |
|---|---|
| PubChem CID | 130510926 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | 2-[2,5-dihydro-1H-pyrrol-2-yl(fluoro)methyl]piperidine |
| SMILES | FC(C1C=CCN1)C1CCCCN1 |
| InChI | InChI=1S/C10H17FN2/c11-10(9-5-3-7-13-9)8-4-1-2-6-12-8/h3,5,8-10,12-13H,1-2,4,6-7H2 |
| InChIKey | VXUFQDFNCWPNCS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|