5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride

C14H14ClNO2 — CID 13051603

IUPAC5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride
SMILESCc1onc(-c2ccc(C(C)C)cc2)c1C(=O)Cl
InChIInChI=1S/C14H14ClNO2/c1-8(2)10-4-6-11(7-5-10)13-12(14(15)17)9(3)18-16-13/h4-8H,1-3H3
InChIKeyPYOWXBIRGJKXPJ-UHFFFAOYSA-N
MW263.72 g/mol
LogP4.15
Rot. Bonds3

About 5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride

5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride (PubChem CID 13051603) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is 5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride.

Molecular Properties

Compound Name5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride
PubChem CID13051603
Molecular FormulaC14H14ClNO2
Molecular Weight263.72 g/mol
Exact Mass263.07
IUPAC Name5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride
SMILESCc1onc(-c2ccc(C(C)C)cc2)c1C(=O)Cl
InChIInChI=1S/C14H14ClNO2/c1-8(2)10-4-6-11(7-5-10)13-12(14(15)17)9(3)18-16-13/h4-8H,1-3H3
InChIKeyPYOWXBIRGJKXPJ-UHFFFAOYSA-N
XLogP4.15
TPSA43.10 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.72
LogP ≤ 54.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride?
The IUPAC name of 5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride (CID 13051603) is 5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride.
What is the SMILES notation for 5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride?
The canonical SMILES for 5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride is Cc1onc(-c2ccc(C(C)C)cc2)c1C(=O)Cl.
What is the InChIKey of 5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride?
The InChIKey is PYOWXBIRGJKXPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClNO2/c1-8(2)10-4-6-11(7-5-10)13-12(14(15)17)9(3)18-16-13/h4-8H,1-3H3.
What are the key properties of 5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride?
5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride has a molecular weight of 263.72 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbonyl chloride is sourced from PubChem (CID 13051603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).