3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride

C13H12ClNO2 — CID 21317239

IUPAC3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride
SMILESCC(C)c1onc(-c2ccccc2)c1C(=O)Cl
InChIInChI=1S/C13H12ClNO2/c1-8(2)12-10(13(14)16)11(15-17-12)9-6-4-3-5-7-9/h3-8H,1-2H3
InChIKeyOQHCHBRIMJZIOK-UHFFFAOYSA-N
MW249.70 g/mol
LogP3.84
Rot. Bonds3

About 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride

3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride (PubChem CID 21317239) has the molecular formula C13H12ClNO2 and a molecular weight of 249.70 g/mol. Its IUPAC name is 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride.

Molecular Properties

Compound Name3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride
PubChem CID21317239
Molecular FormulaC13H12ClNO2
Molecular Weight249.70 g/mol
Exact Mass249.06
IUPAC Name3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride
SMILESCC(C)c1onc(-c2ccccc2)c1C(=O)Cl
InChIInChI=1S/C13H12ClNO2/c1-8(2)12-10(13(14)16)11(15-17-12)9-6-4-3-5-7-9/h3-8H,1-2H3
InChIKeyOQHCHBRIMJZIOK-UHFFFAOYSA-N
XLogP3.84
TPSA43.10 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.70
LogP ≤ 53.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride?
The IUPAC name of 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride (CID 21317239) is 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride.
What is the SMILES notation for 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride?
The canonical SMILES for 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride is CC(C)c1onc(-c2ccccc2)c1C(=O)Cl.
What is the InChIKey of 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride?
The InChIKey is OQHCHBRIMJZIOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO2/c1-8(2)12-10(13(14)16)11(15-17-12)9-6-4-3-5-7-9/h3-8H,1-2H3.
What are the key properties of 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride?
3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride has a molecular weight of 249.70 g/mol, XLogP of 3.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride is sourced from PubChem (CID 21317239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).