C13H12ClNO2 — CID 21317239
3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride (PubChem CID 21317239) has the molecular formula C13H12ClNO2 and a molecular weight of 249.70 g/mol. Its IUPAC name is 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride.
| Compound Name | 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 21317239 |
| Molecular Formula | C13H12ClNO2 |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-phenyl-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride |
| SMILES | CC(C)c1onc(-c2ccccc2)c1C(=O)Cl |
| InChI | InChI=1S/C13H12ClNO2/c1-8(2)12-10(13(14)16)11(15-17-12)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | OQHCHBRIMJZIOK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|