C13H11Cl2NO2 — CID 118060324
3-(2-chlorophenyl)-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride (PubChem CID 118060324) has the molecular formula C13H11Cl2NO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride.
| Compound Name | 3-(2-chlorophenyl)-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 118060324 |
| Molecular Formula | C13H11Cl2NO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 3-(2-chlorophenyl)-5-propan-2-yl-1,2-oxazole-4-carbonyl chloride |
| SMILES | CC(C)c1onc(-c2ccccc2Cl)c1C(=O)Cl |
| InChI | InChI=1S/C13H11Cl2NO2/c1-7(2)12-10(13(15)17)11(16-18-12)8-5-3-4-6-9(8)14/h3-7H,1-2H3 |
| InChIKey | OOEYDYDIKDJSRQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|