About 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole
5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole (PubChem CID 130517490) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole |
| PubChem CID | 130517490 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole |
| SMILES | C=Cc1nc(-c2coc(C)n2)no1 |
| InChI | InChI=1S/C8H7N3O2/c1-3-7-10-8(11-13-7)6-4-12-5(2)9-6/h3-4H,1H2,2H3 |
| InChIKey | VUBNOSDKGYSWFK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole?
The IUPAC name of 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole (CID 130517490) is 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole.
What is the SMILES notation for 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole?
The canonical SMILES for 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole is C=Cc1nc(-c2coc(C)n2)no1.
What is the InChIKey of 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole?
The InChIKey is VUBNOSDKGYSWFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c1-3-7-10-8(11-13-7)6-4-12-5(2)9-6/h3-4H,1H2,2H3.
What are the key properties of 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole?
5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole has a molecular weight of 177.16 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-3-(2-methyl-1,3-oxazol-4-yl)-1,2,4-oxadiazole is sourced from PubChem (CID 130517490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).