C9H12N2O — CID 130518910
1-(2,3-dimethylimidazol-4-yl)-2-methylprop-2-en-1-one (PubChem CID 130518910) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-(2,3-dimethylimidazol-4-yl)-2-methylprop-2-en-1-one.
| Compound Name | 1-(2,3-dimethylimidazol-4-yl)-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 130518910 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1-(2,3-dimethylimidazol-4-yl)-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)c1cnc(C)n1C |
| InChI | InChI=1S/C9H12N2O/c1-6(2)9(12)8-5-10-7(3)11(8)4/h5H,1H2,2-4H3 |
| InChIKey | XOQCMKXRTUPHIP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|