C11H14N2O — CID 130519079
3-(2,3-dimethylimidazol-4-yl)cyclohex-2-en-1-one (PubChem CID 130519079) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-(2,3-dimethylimidazol-4-yl)cyclohex-2-en-1-one.
| Compound Name | 3-(2,3-dimethylimidazol-4-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 130519079 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 3-(2,3-dimethylimidazol-4-yl)cyclohex-2-en-1-one |
| SMILES | Cc1ncc(C2=CC(=O)CCC2)n1C |
| InChI | InChI=1S/C11H14N2O/c1-8-12-7-11(13(8)2)9-4-3-5-10(14)6-9/h6-7H,3-5H2,1-2H3 |
| InChIKey | VFSXDDJDKUMCEN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |