C21H22N2OS — CID 13051922
3-(4-methoxyphenyl)-6,6-dimethyl-2-phenyl-5,7-dihydro-[1,3]thiazolo[3,2-a]pyrimidine (PubChem CID 13051922) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-6,6-dimethyl-2-phenyl-5,7-dihydro-[1,3]thiazolo[3,2-a]pyrimidine.
| Compound Name | 3-(4-methoxyphenyl)-6,6-dimethyl-2-phenyl-5,7-dihydro-[1,3]thiazolo[3,2-a]pyrimidine |
|---|---|
| PubChem CID | 13051922 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3-(4-methoxyphenyl)-6,6-dimethyl-2-phenyl-5,7-dihydro-[1,3]thiazolo[3,2-a]pyrimidine |
| SMILES | COc1ccc(C2=C(c3ccccc3)SC3=NCC(C)(C)CN32)cc1 |
| InChI | InChI=1S/C21H22N2OS/c1-21(2)13-22-20-23(14-21)18(15-9-11-17(24-3)12-10-15)19(25-20)16-7-5-4-6-8-16/h4-12H,13-14H2,1-3H3 |
| InChIKey | CUJCRMHLYSPORY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|