C19H17FN2OS — CID 13051923
2-(2-fluorophenyl)-3-(4-methoxyphenyl)-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine (PubChem CID 13051923) has the molecular formula C19H17FN2OS and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-3-(4-methoxyphenyl)-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine.
| Compound Name | 2-(2-fluorophenyl)-3-(4-methoxyphenyl)-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine |
|---|---|
| PubChem CID | 13051923 |
| Molecular Formula | C19H17FN2OS |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-(2-fluorophenyl)-3-(4-methoxyphenyl)-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine |
| SMILES | COc1ccc(C2=C(c3ccccc3F)SC3=NCCCN32)cc1 |
| InChI | InChI=1S/C19H17FN2OS/c1-23-14-9-7-13(8-10-14)17-18(15-5-2-3-6-16(15)20)24-19-21-11-4-12-22(17)19/h2-3,5-10H,4,11-12H2,1H3 |
| InChIKey | OUGURMMCSDHAGR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|