C10H11BrN2O2 — CID 130522554
(6-bromo-2-pyridinyl)-(1,3-oxazinan-3-yl)methanone (PubChem CID 130522554) has the molecular formula C10H11BrN2O2 and a molecular weight of 271.11 g/mol. Its IUPAC name is (6-bromo-2-pyridinyl)-(1,3-oxazinan-3-yl)methanone.
| Compound Name | (6-bromo-2-pyridinyl)-(1,3-oxazinan-3-yl)methanone |
|---|---|
| PubChem CID | 130522554 |
| Molecular Formula | C10H11BrN2O2 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | (6-bromo-2-pyridinyl)-(1,3-oxazinan-3-yl)methanone |
| SMILES | O=C(c1cccc(Br)n1)N1CCCOC1 |
| InChI | InChI=1S/C10H11BrN2O2/c11-9-4-1-3-8(12-9)10(14)13-5-2-6-15-7-13/h1,3-4H,2,5-7H2 |
| InChIKey | DERFTRYWVHCHQY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|