C10H12N2O2 — CID 110739628
1,3-oxazinan-3-yl(pyridin-4-yl)methanone (PubChem CID 110739628) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 1,3-oxazinan-3-yl(pyridin-4-yl)methanone.
| Compound Name | 1,3-oxazinan-3-yl(pyridin-4-yl)methanone |
|---|---|
| PubChem CID | 110739628 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 1,3-oxazinan-3-yl(pyridin-4-yl)methanone |
| SMILES | O=C(c1ccncc1)N1CCCOC1 |
| InChI | InChI=1S/C10H12N2O2/c13-10(9-2-4-11-5-3-9)12-6-1-7-14-8-12/h2-5H,1,6-8H2 |
| InChIKey | GVYMJJUUBLLRQA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |