C13H16ClN3O2 — CID 167785609
2-chloro-1-[4-(pyridine-4-carbonyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 167785609) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-chloro-1-[4-(pyridine-4-carbonyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(pyridine-4-carbonyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 167785609 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-chloro-1-[4-(pyridine-4-carbonyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | O=C(CCl)N1CCCN(C(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C13H16ClN3O2/c14-10-12(18)16-6-1-7-17(9-8-16)13(19)11-2-4-15-5-3-11/h2-5H,1,6-10H2 |
| InChIKey | MIGHTOJXUHGIBE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|